C10H13FN2 — CID 172576159
3-fluoro-N,4-dimethyl-1-prop-1-en-2-ylpyridin-2-imine (PubChem CID 172576159) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 3-fluoro-N,4-dimethyl-1-prop-1-en-2-ylpyridin-2-imine.
| Compound Name | 3-fluoro-N,4-dimethyl-1-prop-1-en-2-ylpyridin-2-imine |
|---|---|
| PubChem CID | 172576159 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 3-fluoro-N,4-dimethyl-1-prop-1-en-2-ylpyridin-2-imine |
| SMILES | C=C(C)n1ccc(C)c(F)/c1=N\C |
| InChI | InChI=1S/C10H13FN2/c1-7(2)13-6-5-8(3)9(11)10(13)12-4/h5-6H,1H2,2-4H3/b12-10+ |
| InChIKey | CILKJFFKNOLGHQ-ZRDIBKRKSA-N |
| XLogP | 1.96 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |