C9H11FN2 — CID 142309011
6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine (PubChem CID 142309011) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is 6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142309011 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc2c(n1C)=NC(F)CC=2 |
| InChI | InChI=1S/C9H11FN2/c1-6-5-7-3-4-8(10)11-9(7)12(6)2/h3,5,8H,4H2,1-2H3 |
| InChIKey | PDVXBYPWTSKLLN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|