C17H25F3N2 — CID 176970795
(3E)-N-[(Z)-but-2-en-2-yl]-3-butylidene-1-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrol-2-imine (PubChem CID 176970795) has the molecular formula C17H25F3N2 and a molecular weight of 314.40 g/mol. Its IUPAC name is (3E)-N-[(Z)-but-2-en-2-yl]-3-butylidene-1-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrol-2-imine.
| Compound Name | (3E)-N-[(Z)-but-2-en-2-yl]-3-butylidene-1-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrol-2-imine |
|---|---|
| PubChem CID | 176970795 |
| Molecular Formula | C17H25F3N2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (3E)-N-[(Z)-but-2-en-2-yl]-3-butylidene-1-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrol-2-imine |
| SMILES | C/C=C(C)\N=C1C(=C\CCC)\C=C(C(C)(C)C(F)(F)F)N\1C |
| InChI | InChI=1S/C17H25F3N2/c1-7-9-10-13-11-14(16(4,5)17(18,19)20)22(6)15(13)21-12(3)8-2/h8,10-11H,7,9H2,1-6H3/b12-8-,13-10+,21-15- |
| InChIKey | BWCQNNNTZTXRJA-RTDGFILGSA-N |
| XLogP | 5.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|