C11H17FN2 — CID 142309010
ethane;6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine (PubChem CID 142309010) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is ethane;6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | ethane;6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142309010 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | ethane;6-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
| SMILES | CC.Cc1cc2c(n1C)=NC(F)CC=2 |
| InChI | InChI=1S/C9H11FN2.C2H6/c1-6-5-7-3-4-8(10)11-9(7)12(6)2;1-2/h3,5,8H,4H2,1-2H3;1-2H3 |
| InChIKey | DGSZDIXGPLQVBS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|