C19H22FN3 — CID 155197822
(3Z,5E)-8-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N-(2-fluoroethyl)-N,6-dimethylocta-1,3,5-trien-7-yn-2-amine (PubChem CID 155197822) has the molecular formula C19H22FN3 and a molecular weight of 311.40 g/mol. Its IUPAC name is (3Z,5E)-8-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N-(2-fluoroethyl)-N,6-dimethylocta-1,3,5-trien-7-yn-2-amine.
| Compound Name | (3Z,5E)-8-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N-(2-fluoroethyl)-N,6-dimethylocta-1,3,5-trien-7-yn-2-amine |
|---|---|
| PubChem CID | 155197822 |
| Molecular Formula | C19H22FN3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (3Z,5E)-8-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N-(2-fluoroethyl)-N,6-dimethylocta-1,3,5-trien-7-yn-2-amine |
| SMILES | C=C(/C=C\C=C(/C)C#Cc1cc2c([nH]1)=NCCC=2)N(C)CCF |
| InChI | InChI=1S/C19H22FN3/c1-15(6-4-7-16(2)23(3)13-11-20)9-10-18-14-17-8-5-12-21-19(17)22-18/h4,6-8,14H,2,5,11-13H2,1,3H3,(H,21,22)/b7-4-,15-6+ |
| InChIKey | RWCWCULAFSNYGQ-XWBOZUFGSA-N |
| XLogP | 2.09 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|