C19H26FN3 — CID 155197853
(3E,5E)-N-(2-fluoroethyl)-N,6-dimethyl-7-[(4Z)-5-methylimino-4-propylidene-1H-pyrrol-2-yl]hepta-3,5-dien-1-yn-3-amine (PubChem CID 155197853) has the molecular formula C19H26FN3 and a molecular weight of 315.44 g/mol. Its IUPAC name is (3E,5E)-N-(2-fluoroethyl)-N,6-dimethyl-7-[(4Z)-5-methylimino-4-propylidene-1H-pyrrol-2-yl]hepta-3,5-dien-1-yn-3-amine.
| Compound Name | (3E,5E)-N-(2-fluoroethyl)-N,6-dimethyl-7-[(4Z)-5-methylimino-4-propylidene-1H-pyrrol-2-yl]hepta-3,5-dien-1-yn-3-amine |
|---|---|
| PubChem CID | 155197853 |
| Molecular Formula | C19H26FN3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (3E,5E)-N-(2-fluoroethyl)-N,6-dimethyl-7-[(4Z)-5-methylimino-4-propylidene-1H-pyrrol-2-yl]hepta-3,5-dien-1-yn-3-amine |
| SMILES | C#C/C(=C\C=C(/C)CC1=CC(=C/CC)/C(=N/C)N1)N(C)CCF |
| InChI | InChI=1S/C19H26FN3/c1-6-8-16-14-17(22-19(16)21-4)13-15(3)9-10-18(7-2)23(5)12-11-20/h2,8-10,14H,6,11-13H2,1,3-5H3,(H,21,22)/b15-9+,16-8-,18-10+ |
| InChIKey | HHCMKYKDUJIQME-PIBXOMJWSA-N |
| XLogP | 3.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|