C13H16N2 — CID 143620488
5-ethenyl-3-methylidene-N,4-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-imine (PubChem CID 143620488) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-ethenyl-3-methylidene-N,4-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-imine.
| Compound Name | 5-ethenyl-3-methylidene-N,4-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-imine |
|---|---|
| PubChem CID | 143620488 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5-ethenyl-3-methylidene-N,4-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-imine |
| SMILES | C=CC1=C(/C=C\C)C(=C)/C(=N/C=C\C)N1 |
| InChI | InChI=1S/C13H16N2/c1-5-8-11-10(4)13(14-9-6-2)15-12(11)7-3/h5-9H,3-4H2,1-2H3,(H,14,15)/b8-5-,9-6- |
| InChIKey | UTHKRZMNVYTMCM-VVRUXRSYSA-N |
| XLogP | 3.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|