C18H20FN3 — CID 142308904
(2E,4Z)-8-(6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N,N-dimethyl-6-methylideneocta-2,4-dien-7-yn-3-amine (PubChem CID 142308904) has the molecular formula C18H20FN3 and a molecular weight of 297.38 g/mol. Its IUPAC name is (2E,4Z)-8-(6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N,N-dimethyl-6-methylideneocta-2,4-dien-7-yn-3-amine.
| Compound Name | (2E,4Z)-8-(6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N,N-dimethyl-6-methylideneocta-2,4-dien-7-yn-3-amine |
|---|---|
| PubChem CID | 142308904 |
| Molecular Formula | C18H20FN3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2E,4Z)-8-(6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)-N,N-dimethyl-6-methylideneocta-2,4-dien-7-yn-3-amine |
| SMILES | C=C(C#Cc1cc2c([nH]1)=NC(F)CC=2)/C=C\C(=C/C)N(C)C |
| InChI | InChI=1S/C18H20FN3/c1-5-16(22(3)4)10-7-13(2)6-9-15-12-14-8-11-17(19)21-18(14)20-15/h5,7-8,10,12,17H,2,11H2,1,3-4H3,(H,20,21)/b10-7-,16-5+ |
| InChIKey | NOSKNFUMKPENON-NAQSKPHTSA-N |
| XLogP | 2.04 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|