C20H28FN3 — CID 142308959
ethane;(4E,6Z)-1-[(4Z)-4-(2-fluoroethylidene)-5-methylimino-1H-pyrrol-2-yl]-N,N-dimethyl-3-methylideneocta-4,6-dien-1-yn-4-amine (PubChem CID 142308959) has the molecular formula C20H28FN3 and a molecular weight of 329.46 g/mol. Its IUPAC name is ethane;(4E,6Z)-1-[(4Z)-4-(2-fluoroethylidene)-5-methylimino-1H-pyrrol-2-yl]-N,N-dimethyl-3-methylideneocta-4,6-dien-1-yn-4-amine.
| Compound Name | ethane;(4E,6Z)-1-[(4Z)-4-(2-fluoroethylidene)-5-methylimino-1H-pyrrol-2-yl]-N,N-dimethyl-3-methylideneocta-4,6-dien-1-yn-4-amine |
|---|---|
| PubChem CID | 142308959 |
| Molecular Formula | C20H28FN3 |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | ethane;(4E,6Z)-1-[(4Z)-4-(2-fluoroethylidene)-5-methylimino-1H-pyrrol-2-yl]-N,N-dimethyl-3-methylideneocta-4,6-dien-1-yn-4-amine |
| SMILES | C=C(C#CC1=CC(=C/CF)/C(=N/C)N1)/C(=C\C=C/C)N(C)C.CC |
| InChI | InChI=1S/C18H22FN3.C2H6/c1-6-7-8-17(22(4)5)14(2)9-10-16-13-15(11-12-19)18(20-3)21-16;1-2/h6-8,11,13H,2,12H2,1,3-5H3,(H,20,21);1-2H3/b7-6-,15-11-,17-8+; |
| InChIKey | YSMTWQBFUBBGBV-ZFFFMGNFSA-N |
| XLogP | 4.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|