C16H28N2 — CID 144801076
ethane;3-methylidene-N-[(Z)-prop-1-enyl]-1,5-dipropylpyrrol-2-imine (PubChem CID 144801076) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is ethane;3-methylidene-N-[(Z)-prop-1-enyl]-1,5-dipropylpyrrol-2-imine.
| Compound Name | ethane;3-methylidene-N-[(Z)-prop-1-enyl]-1,5-dipropylpyrrol-2-imine |
|---|---|
| PubChem CID | 144801076 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | ethane;3-methylidene-N-[(Z)-prop-1-enyl]-1,5-dipropylpyrrol-2-imine |
| SMILES | C=C1C=C(CCC)N(CCC)/C1=N/C=C\C.CC |
| InChI | InChI=1S/C14H22N2.C2H6/c1-5-8-13-11-12(4)14(15-9-6-2)16(13)10-7-3;1-2/h6,9,11H,4-5,7-8,10H2,1-3H3;1-2H3/b9-6-,15-14+; |
| InChIKey | LYMHGPUMSHQKTL-ZLBVQVRPSA-N |
| XLogP | 4.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|