C17H28FN3 — CID 123669469
N'-[3-[2-fluoroethyl(hexa-3,5-dien-3-yl)amino]-2-methylbuta-1,3-dienyl]-N,N-dimethylethanimidamide (PubChem CID 123669469) has the molecular formula C17H28FN3 and a molecular weight of 293.43 g/mol. Its IUPAC name is N'-[3-[2-fluoroethyl(hexa-3,5-dien-3-yl)amino]-2-methylbuta-1,3-dienyl]-N,N-dimethylethanimidamide.
| Compound Name | N'-[3-[2-fluoroethyl(hexa-3,5-dien-3-yl)amino]-2-methylbuta-1,3-dienyl]-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 123669469 |
| Molecular Formula | C17H28FN3 |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | N'-[3-[2-fluoroethyl(hexa-3,5-dien-3-yl)amino]-2-methylbuta-1,3-dienyl]-N,N-dimethylethanimidamide |
| SMILES | C=CC=C(CC)N(CCF)C(=C)C(C)=C/N=C(\C)N(C)C |
| InChI | InChI=1S/C17H28FN3/c1-8-10-17(9-2)21(12-11-18)15(4)14(3)13-19-16(5)20(6)7/h8,10,13H,1,4,9,11-12H2,2-3,5-7H3/b14-13?,17-10?,19-16+ |
| InChIKey | JOJDXFFFYCZHNP-HONSCZAHSA-N |
| XLogP | 4.14 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|