C12H16N2 — CID 123161013
1-ethyl-3,6-dimethyl-3H-pyrido[1,2-c]pyrimidine (PubChem CID 123161013) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-ethyl-3,6-dimethyl-3H-pyrido[1,2-c]pyrimidine.
| Compound Name | 1-ethyl-3,6-dimethyl-3H-pyrido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 123161013 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-ethyl-3,6-dimethyl-3H-pyrido[1,2-c]pyrimidine |
| SMILES | CCC1=NC(C)C=C2C=C(C)C=CN21 |
| InChI | InChI=1S/C12H16N2/c1-4-12-13-10(3)8-11-7-9(2)5-6-14(11)12/h5-8,10H,4H2,1-3H3 |
| InChIKey | XCJSWMXTBDYOKC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |