C12H18N2 — CID 20677189
2,2,5,6,8-pentamethyl-3H-imidazo[1,2-a]pyridine (PubChem CID 20677189) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2,2,5,6,8-pentamethyl-3H-imidazo[1,2-a]pyridine.
| Compound Name | 2,2,5,6,8-pentamethyl-3H-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 20677189 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2,2,5,6,8-pentamethyl-3H-imidazo[1,2-a]pyridine |
| SMILES | CC1=CC(C)=C(C)N2CC(C)(C)N=C12 |
| InChI | InChI=1S/C12H18N2/c1-8-6-9(2)11-13-12(4,5)7-14(11)10(8)3/h6H,7H2,1-5H3 |
| InChIKey | YDLYANLYJZZRLG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |