C9H10N3Y- — CID 59708926
4,6,7-trimethyl-5-tritio-2H-pyrrolo[2,3-d]pyrimidin-2-ide;yttrium (PubChem CID 59708926) has the molecular formula C9H10N3Y- and a molecular weight of 251.11 g/mol. Its IUPAC name is 4,6,7-trimethyl-5-tritio-2H-pyrrolo[2,3-d]pyrimidin-2-ide;yttrium.
| Compound Name | 4,6,7-trimethyl-5-tritio-2H-pyrrolo[2,3-d]pyrimidin-2-ide;yttrium |
|---|---|
| PubChem CID | 59708926 |
| Molecular Formula | C9H10N3Y- |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 4,6,7-trimethyl-5-tritio-2H-pyrrolo[2,3-d]pyrimidin-2-ide;yttrium |
| SMILES | [3H]c1c(C)n(C)c2n[c-]nc(C)c12.[Y] |
| InChI | InChI=1S/C9H10N3.Y/c1-6-4-8-7(2)10-5-11-9(8)12(6)3;/h4H,1-3H3;/q-1;/i4T; |
| InChIKey | JZTVWIOUJANRDJ-BRGIFKCHSA-N |
| XLogP | 1.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|