C12H14N2 — CID 54528064
3,4,8,9-tetramethyl-7,9-diazabicyclo[4.3.1]deca-1(10),2,4,6(10),7-pentaene (PubChem CID 54528064) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 3,4,8,9-tetramethyl-7,9-diazabicyclo[4.3.1]deca-1(10),2,4,6(10),7-pentaene.
| Compound Name | 3,4,8,9-tetramethyl-7,9-diazabicyclo[4.3.1]deca-1(10),2,4,6(10),7-pentaene |
|---|---|
| PubChem CID | 54528064 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3,4,8,9-tetramethyl-7,9-diazabicyclo[4.3.1]deca-1(10),2,4,6(10),7-pentaene |
| SMILES | CC1=CC2=C=C(C=C1C)N(C)C(C)=N2 |
| InChI | InChI=1S/C12H14N2/c1-8-5-11-7-12(6-9(8)2)14(4)10(3)13-11/h5-6H,1-4H3 |
| InChIKey | YUNCZQQEYPGPFB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |