C10H14N2Y-2 — CID 59890256
6-but-2-en-2-yl-1,2-dimethyl-4,5-dihydropyrimidin-5-ide;yttrium (PubChem CID 59890256) has the molecular formula C10H14N2Y-2 and a molecular weight of 251.14 g/mol. Its IUPAC name is 6-but-2-en-2-yl-1,2-dimethyl-4,5-dihydropyrimidin-5-ide;yttrium.
| Compound Name | 6-but-2-en-2-yl-1,2-dimethyl-4,5-dihydropyrimidin-5-ide;yttrium |
|---|---|
| PubChem CID | 59890256 |
| Molecular Formula | C10H14N2Y-2 |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 6-but-2-en-2-yl-1,2-dimethyl-4,5-dihydropyrimidin-5-ide;yttrium |
| SMILES | C/[C-]=C(\C)C1=[C-]CN=C(C)N1C.[Y] |
| InChI | InChI=1S/C10H14N2.Y/c1-5-8(2)10-6-7-11-9(3)12(10)4;/h7H2,1-4H3;/q-2; |
| InChIKey | ZQQNYOZYNGECPK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|