C9H12N2Y-2 — CID 59890254
6-but-2-en-2-yl-2-methyl-4,5-dihydro-1H-pyrimidin-5-ide;yttrium (PubChem CID 59890254) has the molecular formula C9H12N2Y-2 and a molecular weight of 237.11 g/mol. Its IUPAC name is 6-but-2-en-2-yl-2-methyl-4,5-dihydro-1H-pyrimidin-5-ide;yttrium.
| Compound Name | 6-but-2-en-2-yl-2-methyl-4,5-dihydro-1H-pyrimidin-5-ide;yttrium |
|---|---|
| PubChem CID | 59890254 |
| Molecular Formula | C9H12N2Y-2 |
| Molecular Weight | 237.11 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 6-but-2-en-2-yl-2-methyl-4,5-dihydro-1H-pyrimidin-5-ide;yttrium |
| SMILES | C/[C-]=C(\C)C1=[C-]CN=C(C)N1.[Y] |
| InChI | InChI=1S/C9H12N2.Y/c1-4-7(2)9-5-6-10-8(3)11-9;/h6H2,1-3H3,(H,10,11);/q-2; |
| InChIKey | DRKMJPXCYGTSHJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.11 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|