About 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine
5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine (PubChem CID 59890258) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine.
Analyze 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine?
The IUPAC name of 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine (CID 59890258) is 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine.
What is the SMILES notation for 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine?
The canonical SMILES for 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine is CC=C1CN=C(C)NC1=CC.
What is the InChIKey of 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine?
The InChIKey is YUMZQUALPRNDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-4-8-6-10-7(3)11-9(8)5-2/h4-5H,6H2,1-3H3,(H,10,11).
What are the key properties of 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine?
5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine has a molecular weight of 150.22 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-di(ethylidene)-2-methyl-1,4-dihydropyrimidine is sourced from PubChem (CID 59890258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).