C12H15F3N2 — CID 146359518
N'-methyl-N-[7-methyl-4-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethanimidamide (PubChem CID 146359518) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is N'-methyl-N-[7-methyl-4-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethanimidamide.
| Compound Name | N'-methyl-N-[7-methyl-4-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 146359518 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N'-methyl-N-[7-methyl-4-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethanimidamide |
| SMILES | C/N=C(\C)NC1=CCC(C(F)(F)F)=CC=C1C |
| InChI | InChI=1S/C12H15F3N2/c1-8-4-5-10(12(13,14)15)6-7-11(8)17-9(2)16-3/h4-5,7H,6H2,1-3H3,(H,16,17) |
| InChIKey | NALHWCQKBCWAAH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|