C9H14N2 — CID 59890255
6-but-2-en-2-yl-2-methyl-1,4-dihydropyrimidine (PubChem CID 59890255) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-but-2-en-2-yl-2-methyl-1,4-dihydropyrimidine.
| Compound Name | 6-but-2-en-2-yl-2-methyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 59890255 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 6-but-2-en-2-yl-2-methyl-1,4-dihydropyrimidine |
| SMILES | CC=C(C)C1=CCN=C(C)N1 |
| InChI | InChI=1S/C9H14N2/c1-4-7(2)9-5-6-10-8(3)11-9/h4-5H,6H2,1-3H3,(H,10,11) |
| InChIKey | MUZTYKOYHNJZME-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |