C9H12N2 — CID 142308845
2-ethyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 142308845) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2-ethyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 2-ethyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142308845 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-ethyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCc1cc2c([nH]1)=NCCC=2 |
| InChI | InChI=1S/C9H12N2/c1-2-8-6-7-4-3-5-10-9(7)11-8/h4,6H,2-3,5H2,1H3,(H,10,11) |
| InChIKey | XGTITYHEXFRXAM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |