C10H11N2Y- — CID 59708866
1,2,4-trimethyl-3-tritio-6H-pyrrolo[2,3-b]pyridin-6-ide;yttrium (PubChem CID 59708866) has the molecular formula C10H11N2Y- and a molecular weight of 250.13 g/mol. Its IUPAC name is 1,2,4-trimethyl-3-tritio-6H-pyrrolo[2,3-b]pyridin-6-ide;yttrium.
| Compound Name | 1,2,4-trimethyl-3-tritio-6H-pyrrolo[2,3-b]pyridin-6-ide;yttrium |
|---|---|
| PubChem CID | 59708866 |
| Molecular Formula | C10H11N2Y- |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,2,4-trimethyl-3-tritio-6H-pyrrolo[2,3-b]pyridin-6-ide;yttrium |
| SMILES | [3H]c1c(C)n(C)c2n[c-]cc(C)c12.[Y] |
| InChI | InChI=1S/C10H11N2.Y/c1-7-4-5-11-10-9(7)6-8(2)12(10)3;/h4,6H,1-3H3;/q-1;/i6T; |
| InChIKey | DPGVJGLOPSPESA-IZNLTOPRSA-N |
| XLogP | 1.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|