C10H10N2WY-2 — CID 59708879
1,4-dimethyl-2-methylidene-3-tritio-6H-pyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium (PubChem CID 59708879) has the molecular formula C10H10N2WY-2 and a molecular weight of 432.96 g/mol. Its IUPAC name is 1,4-dimethyl-2-methylidene-3-tritio-6H-pyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium.
| Compound Name | 1,4-dimethyl-2-methylidene-3-tritio-6H-pyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium |
|---|---|
| PubChem CID | 59708879 |
| Molecular Formula | C10H10N2WY-2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.95 |
| IUPAC Name | 1,4-dimethyl-2-methylidene-3-tritio-6H-pyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium |
| SMILES | [3H][C-]1C(=C)N(C)c2n[c-]cc(C)c21.[W].[Y] |
| InChI | InChI=1S/C10H10N2.W.Y/c1-7-4-5-11-10-9(7)6-8(2)12(10)3;;/h4,6H,2H2,1,3H3;;/q-2;;/i6T;; |
| InChIKey | HAVMXJCYYAGOGK-JFCUDOESSA-N |
| XLogP | 1.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|