C12H14N2 — CID 155188665
(3aZ,5Z,7Z,9E)-N,1-dimethyl-3H-cycloocta[b]pyrrol-2-imine (PubChem CID 155188665) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is (3aZ,5Z,7Z,9E)-N,1-dimethyl-3H-cycloocta[b]pyrrol-2-imine.
| Compound Name | (3aZ,5Z,7Z,9E)-N,1-dimethyl-3H-cycloocta[b]pyrrol-2-imine |
|---|---|
| PubChem CID | 155188665 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (3aZ,5Z,7Z,9E)-N,1-dimethyl-3H-cycloocta[b]pyrrol-2-imine |
| SMILES | C/N=C1\CC2=C/C=C\C=C/C=C\2N1C |
| InChI | InChI=1S/C12H14N2/c1-13-12-9-10-7-5-3-4-6-8-11(10)14(12)2/h3-8H,9H2,1-2H3/b4-3-,5-3-,6-4-,7-5-,8-6-,10-7-,11-8+,13-12+ |
| InChIKey | WSKXKWQOHAGPJK-LYLIHKBISA-N |
| XLogP | 2.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|