C15H23N3 — CID 143720645
N-[(4Z,6E)-6-(3-methyl-2-propyl-4H-imidazol-5-ylidene)hepta-1,4-dien-4-yl]methanimine (PubChem CID 143720645) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N-[(4Z,6E)-6-(3-methyl-2-propyl-4H-imidazol-5-ylidene)hepta-1,4-dien-4-yl]methanimine.
| Compound Name | N-[(4Z,6E)-6-(3-methyl-2-propyl-4H-imidazol-5-ylidene)hepta-1,4-dien-4-yl]methanimine |
|---|---|
| PubChem CID | 143720645 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N-[(4Z,6E)-6-(3-methyl-2-propyl-4H-imidazol-5-ylidene)hepta-1,4-dien-4-yl]methanimine |
| SMILES | C=CC/C(=C/C(C)=C1\CN(C)C(CCC)=N1)N=C |
| InChI | InChI=1S/C15H23N3/c1-6-8-13(16-4)10-12(3)14-11-18(5)15(17-14)9-7-2/h6,10H,1,4,7-9,11H2,2-3,5H3/b13-10-,14-12+ |
| InChIKey | VARLFPGCGDSXIU-HOUCWWNKSA-N |
| XLogP | 3.57 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|