C12H13N3 — CID 123324154
2,3-dimethyl-8H-imidazo[4,5-i]quinoline (PubChem CID 123324154) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 2,3-dimethyl-8H-imidazo[4,5-i]quinoline.
| Compound Name | 2,3-dimethyl-8H-imidazo[4,5-i]quinoline |
|---|---|
| PubChem CID | 123324154 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2,3-dimethyl-8H-imidazo[4,5-i]quinoline |
| SMILES | CC1=NC23N=CCC=C2C=CC=C3N1C |
| InChI | InChI=1S/C12H13N3/c1-9-14-12-10(6-4-8-13-12)5-3-7-11(12)15(9)2/h3,5-8H,4H2,1-2H3 |
| InChIKey | SDMWOGQTPMUEJT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |