C10H14N2 — CID 163248834
1,2,3a-trimethyl-4H-benzimidazole (PubChem CID 163248834) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,2,3a-trimethyl-4H-benzimidazole.
| Compound Name | 1,2,3a-trimethyl-4H-benzimidazole |
|---|---|
| PubChem CID | 163248834 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,2,3a-trimethyl-4H-benzimidazole |
| SMILES | CC1=NC2(C)CC=CC=C2N1C |
| InChI | InChI=1S/C10H14N2/c1-8-11-10(2)7-5-4-6-9(10)12(8)3/h4-6H,7H2,1-3H3 |
| InChIKey | YPZAZUTYBXWANS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |