C15H19N2+ — CID 123877246
1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyl-5,6-dihydrobenzimidazol-3-ium (PubChem CID 123877246) has the molecular formula C15H19N2+ and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyl-5,6-dihydrobenzimidazol-3-ium.
| Compound Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyl-5,6-dihydrobenzimidazol-3-ium |
|---|---|
| PubChem CID | 123877246 |
| Molecular Formula | C15H19N2+ |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyl-5,6-dihydrobenzimidazol-3-ium |
| SMILES | C[n+]1cn(CC2C=CC=CC2)c2c1=CCCC=2 |
| InChI | InChI=1S/C15H19N2/c1-16-12-17(11-13-7-3-2-4-8-13)15-10-6-5-9-14(15)16/h2-4,7,9-10,12-13H,5-6,8,11H2,1H3/q+1 |
| InChIKey | SJQBHMWTRNNSNK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|