C21H31N2+ — CID 123590692
1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-4,5-dihydroimidazol-1-ium (PubChem CID 123590692) has the molecular formula C21H31N2+ and a molecular weight of 311.49 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 123590692 |
| Molecular Formula | C21H31N2+ |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-4,5-dihydroimidazol-1-ium |
| SMILES | CC1=CC(C)=C(N2C=[N+](C3=C(C)C=C(C)CC3C)CC2)C(C)C1 |
| InChI | InChI=1S/C21H31N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h9,11,13,17,19H,7-8,10,12H2,1-6H3/q+1 |
| InChIKey | MPMMHKXTAXSDLG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|