C16H23N3 — CID 143552600
1,6-dimethyl-2-[(4-methylidenepiperidin-1-yl)methyl]-5,6-dihydrobenzimidazole (PubChem CID 143552600) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1,6-dimethyl-2-[(4-methylidenepiperidin-1-yl)methyl]-5,6-dihydrobenzimidazole.
| Compound Name | 1,6-dimethyl-2-[(4-methylidenepiperidin-1-yl)methyl]-5,6-dihydrobenzimidazole |
|---|---|
| PubChem CID | 143552600 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 1,6-dimethyl-2-[(4-methylidenepiperidin-1-yl)methyl]-5,6-dihydrobenzimidazole |
| SMILES | C=C1CCN(Cc2nc3c(n2C)=CC(C)CC=3)CC1 |
| InChI | InChI=1S/C16H23N3/c1-12-6-8-19(9-7-12)11-16-17-14-5-4-13(2)10-15(14)18(16)3/h5,10,13H,1,4,6-9,11H2,2-3H3 |
| InChIKey | SOIWKQOIEAVDSB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|