C14H22N3+ — CID 171512074
3,3-dimethyl-7-piperidin-1-yl-4,5-dihydrobenzimidazol-3-ium (PubChem CID 171512074) has the molecular formula C14H22N3+ and a molecular weight of 232.35 g/mol. Its IUPAC name is 3,3-dimethyl-7-piperidin-1-yl-4,5-dihydrobenzimidazol-3-ium.
| Compound Name | 3,3-dimethyl-7-piperidin-1-yl-4,5-dihydrobenzimidazol-3-ium |
|---|---|
| PubChem CID | 171512074 |
| Molecular Formula | C14H22N3+ |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 3,3-dimethyl-7-piperidin-1-yl-4,5-dihydrobenzimidazol-3-ium |
| SMILES | C[N+]1(C)C=NC2=C1CCC=C2N1CCCCC1 |
| InChI | InChI=1S/C14H22N3/c1-17(2)11-15-14-12(7-6-8-13(14)17)16-9-4-3-5-10-16/h7,11H,3-6,8-10H2,1-2H3/q+1 |
| InChIKey | POSBDCACZASTDK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|