C12H18N2 — CID 123730557
2,3,5,6,7a-pentamethyl-3aH-benzimidazole (PubChem CID 123730557) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2,3,5,6,7a-pentamethyl-3aH-benzimidazole.
| Compound Name | 2,3,5,6,7a-pentamethyl-3aH-benzimidazole |
|---|---|
| PubChem CID | 123730557 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2,3,5,6,7a-pentamethyl-3aH-benzimidazole |
| SMILES | CC1=CC2N(C)C(C)=NC2(C)C=C1C |
| InChI | InChI=1S/C12H18N2/c1-8-6-11-12(4,7-9(8)2)13-10(3)14(11)5/h6-7,11H,1-5H3 |
| InChIKey | HCERGTKSKSXVRQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |