C10H14N2 — CID 89146086
2,3,6-trimethyl-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 89146086) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,3,6-trimethyl-2,3-dihydroimidazo[1,2-a]pyridine.
| Compound Name | 2,3,6-trimethyl-2,3-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 89146086 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,3,6-trimethyl-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC1=CN2C(=NC(C)C2C)C=C1 |
| InChI | InChI=1S/C10H14N2/c1-7-4-5-10-11-8(2)9(3)12(10)6-7/h4-6,8-9H,1-3H3 |
| InChIKey | QRTRBBPBOSDDAI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |