C11H16N2 — CID 10797372
5-methyl-8-prop-2-enyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 10797372) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-methyl-8-prop-2-enyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 5-methyl-8-prop-2-enyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 10797372 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 5-methyl-8-prop-2-enyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | C=CCC1=CCC(C)N2CCN=C12 |
| InChI | InChI=1S/C11H16N2/c1-3-4-10-6-5-9(2)13-8-7-12-11(10)13/h3,6,9H,1,4-5,7-8H2,2H3 |
| InChIKey | FDTRGMCJUSQRBB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|