About (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole
(7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole (PubChem CID 71018223) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole.
Molecular Properties
| Compound Name | (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole |
| PubChem CID | 71018223 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole |
| SMILES | CN1C(C2=CCCCC2)=N[C@]2(C)C=CCCC12 |
| InChI | InChI=1S/C15H22N2/c1-15-11-7-6-10-13(15)17(2)14(16-15)12-8-4-3-5-9-12/h7-8,11,13H,3-6,9-10H2,1-2H3/t13?,15-/m1/s1 |
| InChIKey | CNCLJSMOGPHIQV-AWKYBWMHSA-N |
| XLogP | 3.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole?
The IUPAC name of (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole (CID 71018223) is (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole.
What is the SMILES notation for (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole?
The canonical SMILES for (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole is CN1C(C2=CCCCC2)=N[C@]2(C)C=CCCC12.
What is the InChIKey of (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole?
The InChIKey is CNCLJSMOGPHIQV-AWKYBWMHSA-N. The full InChI is InChI=1S/C15H22N2/c1-15-11-7-6-10-13(15)17(2)14(16-15)12-8-4-3-5-9-12/h7-8,11,13H,3-6,9-10H2,1-2H3/t13?,15-/m1/s1.
What are the key properties of (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole?
(7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole has a molecular weight of 230.35 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7aR)-2-(cyclohexen-1-yl)-3,7a-dimethyl-4,5-dihydro-3aH-benzimidazole is sourced from PubChem (CID 71018223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).