C12H12N2 — CID 134852398
3-methyl-5a,9a-dihydropyrido[1,2-a]benzimidazole (PubChem CID 134852398) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-methyl-5a,9a-dihydropyrido[1,2-a]benzimidazole.
| Compound Name | 3-methyl-5a,9a-dihydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 134852398 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-methyl-5a,9a-dihydropyrido[1,2-a]benzimidazole |
| SMILES | CC1=CC2=NC3C=CC=CC3N2C=C1 |
| InChI | InChI=1S/C12H12N2/c1-9-6-7-14-11-5-3-2-4-10(11)13-12(14)8-9/h2-8,10-11H,1H3 |
| InChIKey | MKBACYYEKPFAHB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |