C10H15N2+ — CID 59289989
1,2,3-trimethyl-5,6-dihydrobenzimidazol-3-ium (PubChem CID 59289989) has the molecular formula C10H15N2+ and a molecular weight of 163.24 g/mol. Its IUPAC name is 1,2,3-trimethyl-5,6-dihydrobenzimidazol-3-ium.
| Compound Name | 1,2,3-trimethyl-5,6-dihydrobenzimidazol-3-ium |
|---|---|
| PubChem CID | 59289989 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 1,2,3-trimethyl-5,6-dihydrobenzimidazol-3-ium |
| SMILES | Cc1n(C)c2c([n+]1C)=CCCC=2 |
| InChI | InChI=1S/C10H15N2/c1-8-11(2)9-6-4-5-7-10(9)12(8)3/h6-7H,4-5H2,1-3H3/q+1 |
| InChIKey | YVNCRHZZWWYLGH-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|