About 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole
1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole (PubChem CID 169159780) has the molecular formula C9H9F3N2
and a molecular weight of 202.18 g/mol. Its IUPAC name is 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole.
Analyze 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole?
The IUPAC name of 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole (CID 169159780) is 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole.
What is the SMILES notation for 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole?
The canonical SMILES for 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole is Cn1c(C(F)(F)F)nc2c1=CCCC=2.
What is the InChIKey of 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole?
The InChIKey is YKRIAPPVPGJVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2/c1-14-7-5-3-2-4-6(7)13-8(14)9(10,11)12/h4-5H,2-3H2,1H3.
What are the key properties of 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole?
1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole has a molecular weight of 202.18 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(trifluoromethyl)-5,6-dihydrobenzimidazole is sourced from PubChem (CID 169159780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).