C10H12N2 — CID 59176763
3-ethyl-2-methylidene-3H-imidazo[1,2-a]pyridine (PubChem CID 59176763) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-ethyl-2-methylidene-3H-imidazo[1,2-a]pyridine.
| Compound Name | 3-ethyl-2-methylidene-3H-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 59176763 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-ethyl-2-methylidene-3H-imidazo[1,2-a]pyridine |
| SMILES | C=C1N=C2C=CC=CN2C1CC |
| InChI | InChI=1S/C10H12N2/c1-3-9-8(2)11-10-6-4-5-7-12(9)10/h4-7,9H,2-3H2,1H3 |
| InChIKey | TWXINSUSXYUHKK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |