C23H36N2 — CID 145212763
ethane;N'-[(3E)-4-ethenyl-5-methylhexa-1,3,5-trien-3-yl]-N-methyl-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]propanimidamide (PubChem CID 145212763) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is ethane;N'-[(3E)-4-ethenyl-5-methylhexa-1,3,5-trien-3-yl]-N-methyl-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]propanimidamide.
| Compound Name | ethane;N'-[(3E)-4-ethenyl-5-methylhexa-1,3,5-trien-3-yl]-N-methyl-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]propanimidamide |
|---|---|
| PubChem CID | 145212763 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | ethane;N'-[(3E)-4-ethenyl-5-methylhexa-1,3,5-trien-3-yl]-N-methyl-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]propanimidamide |
| SMILES | C=C/C(=C\C(C)=C/C)N(C)/C(CC)=N/C(C=C)=C(\C=C)C(=C)C.CC |
| InChI | InChI=1S/C21H30N2.C2H6/c1-10-17(8)15-18(11-2)23(9)21(14-5)22-20(13-4)19(12-3)16(6)7;1-2/h10-13,15H,2-4,6,14H2,1,5,7-9H3;1-2H3/b17-10-,18-15+,20-19+,22-21+; |
| InChIKey | GNXNYEJPIINVNP-ISUCSXJPSA-N |
| XLogP | 6.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|