C8H14N2 — CID 91492600
2,4,5,6-tetramethyl-1,4-dihydropyrimidine (PubChem CID 91492600) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,4,5,6-tetramethyl-1,4-dihydropyrimidine.
| Compound Name | 2,4,5,6-tetramethyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 91492600 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2,4,5,6-tetramethyl-1,4-dihydropyrimidine |
| SMILES | CC1=NC(C)C(C)=C(C)N1 |
| InChI | InChI=1S/C8H14N2/c1-5-6(2)9-8(4)10-7(5)3/h6H,1-4H3,(H,9,10) |
| InChIKey | FPPDRTMQSIISSU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |