C7H12N2 — CID 159622763
(4S)-2,4,6-trimethyl-1,4-dihydropyrimidine (PubChem CID 159622763) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (4S)-2,4,6-trimethyl-1,4-dihydropyrimidine.
| Compound Name | (4S)-2,4,6-trimethyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 159622763 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (4S)-2,4,6-trimethyl-1,4-dihydropyrimidine |
| SMILES | CC1=C[C@H](C)N=C(C)N1 |
| InChI | InChI=1S/C7H12N2/c1-5-4-6(2)9-7(3)8-5/h4-5H,1-3H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | VVFQCWANECFWKO-YFKPBYRVSA-N |
| XLogP | 1.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |