About 6-ethyl-2-ethynyl-1,4-dihydropyrimidine
6-ethyl-2-ethynyl-1,4-dihydropyrimidine (PubChem CID 91033465) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 6-ethyl-2-ethynyl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-ethyl-2-ethynyl-1,4-dihydropyrimidine |
| PubChem CID | 91033465 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 6-ethyl-2-ethynyl-1,4-dihydropyrimidine |
| SMILES | C#CC1=NCC=C(CC)N1 |
| InChI | InChI=1S/C8H10N2/c1-3-7-5-6-9-8(4-2)10-7/h2,5H,3,6H2,1H3,(H,9,10) |
| InChIKey | OAYLJIKXEGMXRS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2-ethynyl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-ethynyl-1,4-dihydropyrimidine?
The IUPAC name of 6-ethyl-2-ethynyl-1,4-dihydropyrimidine (CID 91033465) is 6-ethyl-2-ethynyl-1,4-dihydropyrimidine.
What is the SMILES notation for 6-ethyl-2-ethynyl-1,4-dihydropyrimidine?
The canonical SMILES for 6-ethyl-2-ethynyl-1,4-dihydropyrimidine is C#CC1=NCC=C(CC)N1.
What is the InChIKey of 6-ethyl-2-ethynyl-1,4-dihydropyrimidine?
The InChIKey is OAYLJIKXEGMXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-3-7-5-6-9-8(4-2)10-7/h2,5H,3,6H2,1H3,(H,9,10).
What are the key properties of 6-ethyl-2-ethynyl-1,4-dihydropyrimidine?
6-ethyl-2-ethynyl-1,4-dihydropyrimidine has a molecular weight of 134.18 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-ethynyl-1,4-dihydropyrimidine is sourced from PubChem (CID 91033465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).