C12H16N3Rh- — CID 58944573
rhodium;4,5,6-trimethyl-7-propan-2-yl-2H-pyrrolo[2,3-d]pyrimidin-2-ide (PubChem CID 58944573) has the molecular formula C12H16N3Rh- and a molecular weight of 305.19 g/mol. Its IUPAC name is rhodium;4,5,6-trimethyl-7-propan-2-yl-2H-pyrrolo[2,3-d]pyrimidin-2-ide.
| Compound Name | rhodium;4,5,6-trimethyl-7-propan-2-yl-2H-pyrrolo[2,3-d]pyrimidin-2-ide |
|---|---|
| PubChem CID | 58944573 |
| Molecular Formula | C12H16N3Rh- |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | rhodium;4,5,6-trimethyl-7-propan-2-yl-2H-pyrrolo[2,3-d]pyrimidin-2-ide |
| SMILES | Cc1n[c-]nc2c1c(C)c(C)n2C(C)C.[Rh] |
| InChI | InChI=1S/C12H16N3.Rh/c1-7(2)15-10(5)8(3)11-9(4)13-6-14-12(11)15;/h7H,1-5H3;/q-1; |
| InChIKey | GFZWDXVQARLVPG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|