C21H30N2 — CID 54254953
ethane;5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene (PubChem CID 54254953) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is ethane;5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene.
| Compound Name | ethane;5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene |
|---|---|
| PubChem CID | 54254953 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | ethane;5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene |
| SMILES | CC.CC.CC1=C/C2=C/C3=C=C(/C=C(/C=C1C)C2)N(C)C(C)=N3 |
| InChI | InChI=1S/C17H18N2.2C2H6/c1-11-5-14-7-15(6-12(11)2)9-17-10-16(8-14)18-13(3)19(17)4;2*1-2/h5-6,8-9H,7H2,1-4H3;2*1-2H3/b14-8-,15-9-;; |
| InChIKey | QZJLAJBMIXIKIH-HQIQWLCFSA-N |
| XLogP | 5.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |