C19H26N2 — CID 143904574
N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine;ethane (PubChem CID 143904574) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine;ethane.
| Compound Name | N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine;ethane |
|---|---|
| PubChem CID | 143904574 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine;ethane |
| SMILES | C=Cn1c(C)ccc/c1=N\C/C1=C/CC=C/C=C\C1.CC |
| InChI | InChI=1S/C17H20N2.C2H6/c1-3-19-15(2)10-9-13-17(19)18-14-16-11-7-5-4-6-8-12-16;1-2/h3-7,9-10,12-13H,1,8,11,14H2,2H3;1-2H3/b6-4?,7-5-,16-12+,18-17+; |
| InChIKey | NWVWJPGGEQDDKW-AGGMSENGSA-N |
| XLogP | 4.66 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|