C18H24ClN3 — CID 91153770
1-N-butyl-1-(5-chloro-2-methylidene-1-pyridinyl)-2-ethylidene-3-N-methylpent-4-ene-1,3-diimine (PubChem CID 91153770) has the molecular formula C18H24ClN3 and a molecular weight of 317.86 g/mol. Its IUPAC name is 1-N-butyl-1-(5-chloro-2-methylidene-1-pyridinyl)-2-ethylidene-3-N-methylpent-4-ene-1,3-diimine.
| Compound Name | 1-N-butyl-1-(5-chloro-2-methylidene-1-pyridinyl)-2-ethylidene-3-N-methylpent-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 91153770 |
| Molecular Formula | C18H24ClN3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-N-butyl-1-(5-chloro-2-methylidene-1-pyridinyl)-2-ethylidene-3-N-methylpent-4-ene-1,3-diimine |
| SMILES | C=C/C(=N\C)C(=CC)/C(=N\CCCC)N1C=C(Cl)C=CC1=C |
| InChI | InChI=1S/C18H24ClN3/c1-6-9-12-21-18(16(7-2)17(8-3)20-5)22-13-15(19)11-10-14(22)4/h7-8,10-11,13H,3-4,6,9,12H2,1-2,5H3/b16-7?,20-17+,21-18+ |
| InChIKey | MZCSWEADYADZQX-SNJYODCASA-N |
| XLogP | 4.85 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|