About 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole
1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole (PubChem CID 134288755) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole.
Analyze 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole?
The IUPAC name of 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole (CID 134288755) is 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole.
What is the SMILES notation for 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole?
The canonical SMILES for 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole is CC1=c2nc(C)n(C)c2=CCCC1.
What is the InChIKey of 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole?
The InChIKey is VOYDNSRPYOAHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-8-6-4-5-7-10-11(8)12-9(2)13(10)3/h7H,4-6H2,1-3H3.
What are the key properties of 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole?
1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole has a molecular weight of 176.26 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trimethyl-6,7-dihydro-5H-cyclohepta[d]imidazole is sourced from PubChem (CID 134288755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).