C15H30N2 — CID 143526407
(4E,5E)-1,2-dimethyl-4,5-di(propylidene)imidazole;ethane (PubChem CID 143526407) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is (4E,5E)-1,2-dimethyl-4,5-di(propylidene)imidazole;ethane.
| Compound Name | (4E,5E)-1,2-dimethyl-4,5-di(propylidene)imidazole;ethane |
|---|---|
| PubChem CID | 143526407 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | (4E,5E)-1,2-dimethyl-4,5-di(propylidene)imidazole;ethane |
| SMILES | CC.CC.CC/C=c1/nc(C)n(C)/c1=C/CC |
| InChI | InChI=1S/C11H18N2.2C2H6/c1-5-7-10-11(8-6-2)13(4)9(3)12-10;2*1-2/h7-8H,5-6H2,1-4H3;2*1-2H3/b10-7+,11-8+;; |
| InChIKey | RJJJWTSESVENJU-VHZUSOFISA-N |
| XLogP | 3.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |