C17H18N2 — CID 54254954
5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene (PubChem CID 54254954) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene.
| Compound Name | 5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene |
|---|---|
| PubChem CID | 54254954 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 5,6,11,12-tetramethyl-4,6-diazatricyclo[7.4.1.13,7]pentadeca-1,3(15),4,7(15),8,10,12-heptaene |
| SMILES | CC1=C/C2=C/C3=C=C(/C=C(/C=C1C)C2)N(C)C(C)=N3 |
| InChI | InChI=1S/C17H18N2/c1-11-5-14-7-15(6-12(11)2)9-17-10-16(8-14)18-13(3)19(17)4/h5-6,8-9H,7H2,1-4H3/b14-8-,15-9- |
| InChIKey | XVVWRSULDDVZOI-SFGFDRCGSA-N |
| XLogP | 3.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |